![Thieno[3,2-d]pyrimidine,4-chloro-2-methyl- (CAS: 319442-16-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0645581.png "Thieno[3,2-d]pyrimidine,4-chloro-2-methyl- chemical structure")
Thieno[3,2-d]pyrimidine,4-chloro-2-methyl-
Catalog No: FT-0645581
CAS No: 319442-16-5
- Chemical Name: Thieno[3,2-d]pyrimidine,4-chloro-2-methyl-
- Molecular Formula: C7H5ClN2S
- Molecular Weight: 184.65
- InChI Key: OSAOHHSXWALXET-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5ClN2S/c1-4-9-5-2-3-11-6(5)7(8)10-4/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 184.646 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 319442-16-5 |
| Bolling_Point: | N/A |
| Product_Name: | 4-Chloro-2-methylthieno[3,2-d]pyrimidine |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C7H5ClN2S |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 2.78 |
| Refractive_Index: | 1.682 |
| FW: | 184.646 |
| PSA: | 54.02000 |
| MF: | C7H5ClN2S |
| Exact_Mass: | 183.986191 |
| Warning_Statement: | P301 + P310-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H301-H319 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
![5,7-Dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxine (CAS: 174508-31-7) - Related Chemical Product](/static/img/prod_pic/FT-0660060.png "5,7-Dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxine chemical structure")
